BD0985853
Di-tert-butyl(1-methyl-2,2-diphenylcyclopropyl)phosphine , 98% , 742103-27-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB220.00 | In Stock |
|
| 1g | RMB548.80 | In Stock |
|
| 5g | RMB1960.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-91°C |
| Boiling point: | 427.3±45.0 °C(Predicted) |
| form | solid |
| color | white to pale yellow |
| Sensitive | air sensitive, store cold |
| InChI | 1S/C24H33P/c1-21(2,3)25(22(4,5)6)23(7)18-24(23,19-14-10-8-11-15-19)20-16-12-9-13-17-20/h8-17H,18H2,1-7H3 |
| InChIKey | QMLPJDVGNRHGJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(C(C)(C)C)C1(C)CC1(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 742103-27-1 |
Description and Uses
Ligand for greener Buchwald-Hartwig coupling in TPGS-750-M.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| WGK Germany | 3 |
| HS Code | 2931499090 |
| Storage Class | 11 - Combustible Solids |
