BD0989853
2-(4-Nitrophenyl)butanoicacid , 98% , 7463-53-8
CAS NO.：7463-53-8
Empirical Formula: C10H11NO4
Molecular Weight: 209.2
MDL number: MFCD00156935
EINECS: 231-256-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB44.00 | In Stock |
|
| 25g | RMB156.80 | In Stock |
|
| 100g | RMB616.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-123 °C |
| Boiling point: | 371.2±25.0 °C(Predicted) |
| Density | 1.287±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 3.91±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C10H11NO4/c1-2-9(10(12)13)7-3-5-8(6-4-7)11(14)15/h3-6,9H,2H2,1H3,(H,12,13) |
| InChIKey | XBGNOMBPRQVJSR-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(C1=CC=C([N+]([O-])=O)C=C1)CC |
Description and Uses
2-(4-Nitrophenyl)butyric acid is a key intermediate in the synthesis of indobufen, a new generation of anti-platelet aggregation agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P403+P233-P501 |
