BD1002832
(1-Methyl-1H-pyrazol-4-yl)boronic acid , 95% , 847818-55-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB29.60 | In Stock |
|
| 1g | RMB48.00 | In Stock |
|
| 5g | RMB188.00 | In Stock |
|
| 10g | RMB343.20 | In Stock |
|
| 25g | RMB834.40 | In Stock |
|
| 100g | RMB3241.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 323 ºC |
| Density | 1.23 |
| Flash point: | 149 ºC |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | 7.77±0.10(Predicted) |
| form | solid |
| color | White |
| InChI | InChI=1S/C4H7BN2O2/c1-7-3-4(2-6-7)5(8)9/h2-3,8-9H,1H3 |
| InChIKey | RYGOBSYXIIUFOR-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C)N=C1)(O)O |
Description and Uses
1-Methyl-1H-pyrazole-4-boronic acid is used in the synthesis of c-Met kinase inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |




