BD1004732
1-Methyl-4-nitro-2-(trifluoromethyl)benzene , 97% , 89976-12-5
CAS NO.:89976-12-5
Empirical Formula: C8H6F3NO2
Molecular Weight: 205.13
MDL number: MFCD01631684
EINECS: 806-491-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB57.60 | In Stock |
|
| 10g | RMB100.80 | In Stock |
|
| 25g | RMB220.80 | In Stock |
|
| 100g | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-35 °C |
| Boiling point: | 220.5±35.0 °C(Predicted) |
| Density | 1.357±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Solid |
| color | Off-white |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C8H6F3NO2/c1-5-2-3-6(12(13)14)4-7(5)8(9,10)11/h2-4H,1H3 |
| InChIKey | SVQCVQCIZWSPPX-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C([N+]([O-])=O)C=C1C(F)(F)F |
| CAS DataBase Reference | 89976-12-5(CAS DataBase Reference) |
Description and Uses
2-METHYL-5-NITROBENZOTRIFLUORIDE can be employed as an important intermediate for raw material for organic synthesis, agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-26-36/37/39 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT-HARMFUL |
| HazardClass | 6.1 |
| HS Code | 2904990090 |







