PRODUCT Properties
| Melting point: | 23-25 °C |
| Boiling point: | 103-104°C 18mm |
| Density | 1.539±0.06 g/cm3(Predicted) |
| form | solid |
| InChI | 1S/C8H3F6NO2/c9-7(10,11)5-2-1-4(15(16)17)3-6(5)8(12,13)14/h1-3H |
| InChIKey | QGNGVSKFAUEJDF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1c(ccc(c1)[N+](=O)[O-])C(F)(F)F |
Description and Uses
3,4-Bis(trifluoromethyl)nitrobenzene is used as reactant in the sythetic preparation of 4,5-bis(trifluoromethyl)benzimidazole.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-37/39 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HS Code | 2904990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
