BD1008732
tert-Butyl 3-bromopiperidine-1-carboxylate , 97% , 849928-26-3
CAS NO.：849928-26-3
Empirical Formula: C10H18BrNO2
Molecular Weight: 264.16
MDL number: MFCD07779077
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB101.60 | In Stock |
|
| 250mg | RMB143.20 | In Stock |
|
| 1g | RMB430.40 | In Stock |
|
| 5g | RMB1569.60 | In Stock |
|
| 25g | RMB4742.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 296.6±33.0 °C(Predicted) |
| Density | 1.327 |
| refractive index | n/D 1.488 |
| storage temp. | 2-8°C |
| pka | -3.04±0.40(Predicted) |
| form | liquid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C10H18BrNO2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7H2,1-3H3 |
| InChIKey | YCUDHDNCZHPAJK-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC(Br)C1 |
Description and Uses
1-N-BOC-3-bromopiperidine is a valuable compound in organic synthesis, it is used as a protecting group for the piperidine nitrogen.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H410 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| HS Code | 2933399990 |
