BD1011432
1,1,3-Trimethyl-3-phenyl-2,3-dihydro-1H-indene , 98% , 3910-35-8
CAS NO.:3910-35-8
Empirical Formula: C18H20
Molecular Weight: 236.35
MDL number: MFCD00021240
EINECS: 223-467-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB88.00 | In Stock |
|
| 1g | RMB216.80 | In Stock |
|
| 5g | RMB683.20 | In Stock |
|
| 10g | RMB1144.80 | In Stock |
|
| 25g | RMB2187.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52.5°C |
| Boiling point: | 313.82°C (rough estimate) |
| Density | 1.0009 |
| refractive index | 1.5681 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Dichloromethane; Ethyl Acetate |
| form | Solid |
| color | Brown |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | InChI=1S/C18H20/c1-17(2)13-18(3,14-9-5-4-6-10-14)16-12-8-7-11-15(16)17/h4-12H,13H2,1-3H3 |
| InChIKey | ICLPNZMYHDVKKI-UHFFFAOYSA-N |
| SMILES | C1(C)(C)C2=C(C=CC=C2)C(C)(C2=CC=CC=C2)C1 |
| LogP | 5.715 (est) |
| EPA Substance Registry System | 1H-Indene, 2,3-dihydro-1,1,3-trimethyl-3-phenyl- (3910-35-8) |
Description and Uses
1,1,3-Trimethyl-3-phenylindan is an intermediate in the synthesis of OctaInd (O237100). OctaInd is a commercial brominated flame retardant (BFR) used in styrenic and engineering thermoplastics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| TSCA | TSCA listed |




![3,3,3',3'-Tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol](https://img.chemicalbook.com/CAS/GIF/1568-80-5.gif)

