BD1037632
5-Methoxy-2-nitrobenzaldehyde , 98% , 20357-24-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1g | RMB60.80 | In Stock |
|
| 5g | RMB204.00 | In Stock |
|
| 10g | RMB377.60 | In Stock |
|
| 25g | RMB753.60 | In Stock |
|
| 100g | RMB2164.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83 °C |
| Boiling point: | 354.7±27.0 °C(Predicted) |
| Density | 1.322±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystalline solid |
| color | Yellow |
| InChI | InChI=1S/C8H7NO4/c1-13-7-2-3-8(9(11)12)6(4-7)5-10/h2-5H,1H3 |
| InChIKey | BNTDDWPHSMILHQ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(OC)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 20357-24-8(CAS DataBase Reference) |
Description and Uses
5-Methoxy-2-nitrobenzaldehyde is a starting material used to synthesize a novel class of cis-locked combretastatins named combretabenzodiazepines which shows cytotoxic and antitubulin activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| WGK Germany | WGK 3 |
| HS Code | 2912490090 |
| Storage Class | 11 - Combustible Solids |







