BD1038532
2-(4-Hydroxy-3-nitrophenyl)acetic acid , 98% , 10463-20-4
CAS NO.:10463-20-4
Empirical Formula: C8H7NO5
Molecular Weight: 197.14
MDL number: MFCD00007122
EINECS: 233-948-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB97.60 | In Stock |
|
| 5g | RMB364.80 | In Stock |
|
| 25g | RMB1342.40 | In Stock |
|
| 100g | RMB4056.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-148 °C (lit.) |
| Boiling point: | 334.23°C (rough estimate) |
| Density | 1.5023 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | ethanol: soluble5%, clear, yellow to orange |
| form | crystalline |
| pka | 4.25±0.10(Predicted) |
| color | yellow |
| BRN | 2696044 |
| InChI | 1S/C8H7NO5/c10-7-2-1-5(4-8(11)12)3-6(7)9(13)14/h1-3,10H,4H2,(H,11,12) |
| InChIKey | QBHBHOSRLDPIHG-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1ccc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 10463-20-4(CAS DataBase Reference) |
Description and Uses
4-Hydroxy-3-nitrophenylacetic acid was used in the synthesis of 4-hydroxy-3-nitrophenylacetyl caproic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






