BD1078532
2,2,6,6-Tetramethylheptane-3,5-dione , 97% , 1118-71-4
Synonym(s):
Dipivaloylmethane
CAS NO.:1118-71-4
Empirical Formula: C11H20O2
Molecular Weight: 184.28
MDL number: MFCD00008848
EINECS: 214-268-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB44.00 | In Stock |
|
| 25g | RMB96.80 | In Stock |
|
| 100g | RMB365.60 | In Stock |
|
| 500g | RMB1722.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >400 °C (decomp) |
| Boiling point: | 72-73 °C/6 mmHg (lit.) |
| Density | 0.883 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 153 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Difficult to mix. |
| pka | 11.60±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Specific Gravity | 0.883 |
| BRN | 1447269 |
| InChI | 1S/C11H20O2/c1-10(2,3)8(12)7-9(13)11(4,5)6/h7H2,1-6H3 |
| InChIKey | YRAJNWYBUCUFBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C |
| LogP | 2.818 (est) |
| CAS DataBase Reference | 1118-71-4(CAS DataBase Reference) |
| EPA Substance Registry System | 3,5-Heptanedione, 2,2,6,6-tetramethyl- (1118-71-4) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H302 |
| Precautionary statements | P210e-P264-P280a-P301+P312a-P501a-P210-P280-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-40-36/37/38 |
| Safety Statements | 24/25-36-26-22 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29141900 |
| Storage Class | 10 - Combustible liquids |






