PRODUCT Properties
| Melting point: | 221-223 °C(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2334889 |
| InChI | 1S/C14H12O4S2/c15-19(16,13-7-3-1-4-8-13)11-12-20(17,18)14-9-5-2-6-10-14/h1-12H/b12-11+ |
| InChIKey | YGBXMKGCEHIWMO-VAWYXSNFSA-N |
| SMILES | O=S(=O)(\C=C\S(=O)(=O)c1ccccc1)c2ccccc2 |
Description and Uses
trans-1,2-Bis(phenylsulfonyl)ethylene is useful for the synthesis of dysiherbaine and neodysiherbaine A.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29041000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
