PRODUCT Properties
| Melting point: | 254-256°C |
| Boiling point: | 384.5±42.0 °C(Predicted) |
| Density | 1.612±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 2.00±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C11H7ClO4/c1-15-11(14)10-5-8(13)7-4-6(12)2-3-9(7)16-10/h2-5H,1H3 |
| InChIKey | QADCAYSHKOBAAQ-UHFFFAOYSA-N |
| SMILES | COC(C1=CC(C2=C(O1)C=CC(Cl)=C2)=O)=O |
| CAS DataBase Reference | 5006-45-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H310-H319 |
| Precautionary statements | P262-P264-P280-P280-P302+P352+P310-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| RTECS | DJ2260650 |
| HazardClass | IRRITANT |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
