BD1089832
2,3,6,7,10,11-Hexabromotriphenylene , 98% , 82632-80-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB140.80 | In Stock |
|
| 250mg | RMB336.80 | In Stock |
|
| 1g | RMB630.40 | In Stock |
|
| 5g | RMB2108.80 | In Stock |
|
| 10g | RMB3983.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 689.8±50.0 °C(Predicted) |
| Density | 2.428±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Light yellow to Light red |
| InChI | InChI=1S/C18H6Br6/c19-13-1-7-8(2-14(13)20)10-4-17(23)18(24)6-12(10)11-5-16(22)15(21)3-9(7)11/h1-6H |
| InChIKey | GLHQUXLCQLQNPZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(C3C(C4C2=CC(Br)=C(Br)C=4)=CC(Br)=C(Br)C=3)=CC(Br)=C1Br |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 29039990 |
