BD1529648
3-Bromophenanthrene , 98%HPLC , 715-50-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB117.60 | In Stock |
|
| 1g | RMB293.60 | In Stock |
|
| 5g | RMB1028.80 | In Stock |
|
| 25g | RMB3600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-86 °C |
| Boiling point: | 389.7±11.0 °C(Predicted) |
| Density | 1.479±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C14H9Br/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9H |
| InChIKey | BNGNNFQSUWVWCW-UHFFFAOYSA-N |
| SMILES | C1=C2C(C3C(C=C2)=CC=CC=3)=CC(Br)=C1 |
Description and Uses
3-Bromophenanthrene can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development processes and chemical production processes.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335-H410 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-50/53-41-37/38 |
| Safety Statements | 22-36/37/39-61-60-39-26 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2903998090 |
