PRODUCT Properties
| Boiling point: | 132 °C |
| Density | 0.96 |
| refractive index | 1.5130 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C10H12O/c1-8-3-5-10(6-4-8)7-9(2)11/h3-6H,7H2,1-2H3 |
| InChIKey | NOXKUHSBIXPZBJ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C=C1)C(=O)C |
| CAS DataBase Reference | 2096-86-8(CAS DataBase Reference) |
Description and Uses
4-Methylphenylacetone is a useful compound in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
