PRODUCT Properties
| Melting point: | 112 °C(Solv: methanol (67-56-1)) |
| Boiling point: | 340 °C |
| Density | 1,21 g/cm3 |
| refractive index | 1.6513 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -0.20±0.30(Predicted) |
| form | Oil |
| color | Pale Yellow to Yellow |
| InChI | InChI=1S/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| InChIKey | OHHIBZKYXJDQEU-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=CC(Cl)=C1 |
| CAS DataBase Reference | 101-17-7(CAS DataBase Reference) |
Description and Uses
3-Chlorodiphenylamine (cas# 101-17-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Risk Statements | 20/21/22 |
| Safety Statements | 28-36/37 |
