A2475212
Clomipramine HCl , ≥99% , 17321-77-6
Synonym(s):
3-Chloro-10,11-dihydro-N,N-dimethyl-5H-dibenz[b,f]azepine-5-propanamine hydrochloride;Anafranil hydrochloride;Clomipramine hydrochloride
CAS NO.:17321-77-6
Empirical Formula: C19H24Cl2N2
Molecular Weight: 351.31
MDL number: MFCD00069234
EINECS: 241-344-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB150.40 | In Stock |
|
| 5G | RMB577.60 | In Stock |
|
| 25G | RMB1064.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-190°C |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | H2O: 25 mg/mL |
| form | powder |
| color | white to off-white |
| PH | 3.5~5.0(100g/l,25℃) |
| BCS Class | 3/1 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H |
| InChIKey | WIMWMKZEIBHDTH-UHFFFAOYSA-N |
| SMILES | N1(CCCN(C)C)C2C=CC=CC=2CCC2C=CC(Cl)=CC1=2.Cl |
| CAS DataBase Reference | 17321-77-6(CAS DataBase Reference) |
Description and Uses
Clomipramine is a tricyclic antidepressant, the 3-
Potent, selective 5-HT uptake blocker
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H336-H370-H410 |
| Precautionary statements | P260-P264-P270-P273-P301+P312-P308+P311 |
| target organs | Central nervous system, Central nervous system,Cardiovascular |
| Hazard Codes | Xn,T,F |
| Risk Statements | 20/21/22-39/23/24/25-23/24/25-11-36/37/38 |
| Safety Statements | 36-45-36/37-16-7-62-38-36/37/39-28-26-24/25-22-20/21-13 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | HN9055000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933996100 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT SE 1 STOT SE 3 |








