A2716512
Chlorprothixene hydrochloride , 98% , 6469-93-8
Synonym(s):
2-Chloro-9-(3-dimethylaminopropylidene)thioxanthene hydrochloride
CAS NO.：6469-93-8
Empirical Formula: C18H19Cl2NS
Molecular Weight: 352.32
MDL number: MFCD01941605
EINECS: 229-289-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB183.20 | In Stock |
|
| 5G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224-226?C |
| storage temp. | 2-8°C |
| solubility | Soluble in water and in alcohol, slightly soluble in methylene chloride. |
| form | Solid |
| color | White to off-white |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C18H18ClNS.ClH/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18;/h3-4,6-10,12H,5,11H2,1-2H3;1H/b14-7-; |
| InChIKey | YWKRLOSRDGPEJR-KIUKIJHYSA-N |
| SMILES | Cl.CN(C)CC\C=C1\c2ccccc2Sc3ccc(Cl)cc13 |
| CAS DataBase Reference | 6469-93-8 |
Description and Uses
Neuroleptic;D2 dopamine receptor antagonist
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P330+P331+P310 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XO0610000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
