M2682235
Flupentixoldihydrochloride , ≥99% , 2413-38-9
Synonym(s):
4-[3-[2-(Trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]-1-piperazineethanol dihydrochloride
CAS NO.:2413-38-9
Empirical Formula: C23H25F3N2OS.2ClH
Molecular Weight: 507.44
MDL number: MFCD00069278
EINECS: 219-321-4
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB319.20 | In Stock |
|
| 10mg | RMB638.40 | In Stock |
|
| 50mg | RMB1560.00 | In Stock |
|
| 100mg | RMB2340.00 | In Stock |
|
| 500mg | RMB4800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237-239 °C(Solv: ethanol (64-17-5); methanol (67-56-1)) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | H2O: soluble |
| form | solid |
| color | white or off-white |
| Water Solubility | soluble |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | InChI=1S/C23H25F3N2OS.ClH/c24-23(25,26)17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)30-22)5-3-9-27-10-12-28(13-11-27)14-15-29;/h1-2,4-8,16,29H,3,9-15H2;1H |
| InChIKey | ZQAWQVWCKYGMNE-UHFFFAOYSA-N |
| SMILES | Cl.C(=C1C2=CC=CC=C2SC2=CC=C(C(F)(F)F)C=C12)CCN1CCN(CCO)CC1 |
| CAS DataBase Reference | 2413-38-9 |
Description and Uses
Neuroleptic agent related structurally to thiothixene. Antipsychotic; neuroleptic agent; dopamine receptor antagonist.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | TL9900000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 oral in rat: 791mg/kg |





