A2484312
Chlorpromazine hydrochloride , ≥98%(HPLC) , 69-09-0
Synonym(s):
2-Chloro-10-(3-dimethylaminopropyl)phenothiazine hydrochloride;Chlorpromazine, Hydrochloride - CAS 69-09-0 - Calbiochem;CPZ;Largactil
CAS NO.:69-09-0
Empirical Formula: C17H20Cl2N2S
Molecular Weight: 355.33
MDL number: MFCD00012654
EINECS: 200-701-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB73.60 | In Stock |
|
| 25G | RMB203.20 | In Stock |
|
| 100G | RMB720.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-196°C |
| Density | 1.2221 (estimate) |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Very soluble in water, freely soluble in ethanol (96 per cent). It decomposes on exposure to air and light. |
| form | Powder/Solution |
| color | White to off-white or clear colorless |
| PH | pH (50g/L, 25℃) : 4.0~5.0 |
| biological source | synthetic (organic) |
| Water Solubility | >=10 g/100 mL at 24 ºC |
| Merck | 14,2185 |
| BRN | 3779989 |
| BCS Class | 3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. Air and light sesnsitive. |
| InChI | 1S/C17H19ClN2S.ClH/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20;/h3-4,6-9,12H,5,10-11H2,1-2H3;1H |
| InChIKey | FBSMERQALIEGJT-UHFFFAOYSA-N |
| SMILES | Cl[H].CN(C)CCCN1c2ccccc2Sc3ccc(Cl)cc13 |
| CAS DataBase Reference | 69-09-0(CAS DataBase Reference) |
| EPA Substance Registry System | Chlorpromazine hydrochloride (69-09-0) |
Description and Uses
Antiemetic;Dopamine antagonist
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H330 |
| Precautionary statements | P260-P264-P270-P271-P284-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,T,F |
| Risk Statements | 25-26-39/23/24/25-23/24/25-11 |
| Safety Statements | 28-36/37-45-16 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | SO1750000 |
| F | 3-10-21 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29173980 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 3 Oral |
| Toxicity | LD50 orally in rats: 225 mg/kg (Goldenthal) |






