BD1120848
4-Chloro-1-(chloromethyl)-2-nitrobenzene , 95+% , 938-71-6
Synonym(s):
α,4-Dichloro-2-nitrotoluene
CAS NO.:938-71-6
Empirical Formula: C7H5Cl2NO2
Molecular Weight: 206.03
MDL number: MFCD00007216
EINECS: 213-345-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2709.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-44 °C(lit.) |
| Boiling point: | 160-170 °C(Press: 11 Torr) |
| Density | 1.4062 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| InChI | 1S/C7H5Cl2NO2/c8-4-5-1-2-6(9)3-7(5)10(11)12/h1-3H,4H2 |
| InChIKey | OMPHLGROCARZOU-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(Cl)ccc1CCl |
Description and Uses
4-Chloro-2-nitrobenzyl chloride has been used in the synthesis of 3-iodothyronamine.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049095 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |







