BD1123032
2,5-Dichloro-4,6-dimethylnicotinonitrile , 98% , 91591-63-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB35.20 | In Stock |
|
| 5g | RMB80.80 | In Stock |
|
| 25g | RMB144.80 | In Stock |
|
| 100g | RMB523.20 | In Stock |
|
| 500g | RMB2400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82 °C |
| Boiling point: | 304.6±37.0 °C(Predicted) |
| Density | 1.36 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | -2.79±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C8H6Cl2N2/c1-4-6(3-11)8(10)12-5(2)7(4)9/h1-2H3 |
| InChIKey | UCGWYTUBYASPFG-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=C(Cl)C(C)=C1C#N |
Description and Uses
2,5-Dichloro-4,6-dimethyl-3-pyridinecarbonitrile, can be used for the synthesis of a selective muscarinic receptor 4 (M4) positive allosteric modulator called ML253, which is a potent and brain penetrant compound that is active in a preclinical model of schizophrenia.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
