PRODUCT Properties
| Melting point: | 224 °C |
| Boiling point: | 365.2±42.0 °C(Predicted) |
| Density | 1.957±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| pka | 3.69±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C8H6Br2O3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3H,1H3,(H,11,12) |
| InChIKey | NAHPGFGVWWKSFU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=C(OC)C(Br)=C1 |
| CAS DataBase Reference | 4073-35-2(CAS DataBase Reference) |
Description and Uses
3,5-Dibromo-4-methoxybenzoic acid (3,5-Dibromo-p-anisic acid) is a brominated alkaloid that can be isolated from sponges such as Amphimedon sp. and Psammaplysilla purpurea[1][2].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2918999090 |
