BD1138232
tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate , 95% , 896464-16-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB85.60 | In Stock |
|
| 250mg | RMB143.20 | In Stock |
|
| 1g | RMB364.00 | In Stock |
|
| 5g | RMB1300.00 | In Stock |
|
| 25g | RMB4343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 319 °C |
| Density | 1.08 |
| Flash point: | 147 °C |
| storage temp. | 2-8°C(protect from light) |
| pka | 10.68±0.20(Predicted) |
| form | oil |
| color | Light yellow |
| InChI | InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-6-4-12(5-7-14)8-13-9-12/h13H,4-9H2,1-3H3 |
| InChIKey | NRADOPGBTAJXKB-UHFFFAOYSA-N |
| SMILES | C1C2(CCN(C(OC(C)(C)C)=O)CC2)CN1 |
Description and Uses
2,7-Diazaspiro[3.5]nonane-7-carboxylic Acid tert-Butyl Ester is a reagent in the synthesis of RET kinase inhibitors. In addition it is used in the preparation of CDK4/6 inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| RIDADR | UN2811 |
| HS Code | 2933998090 |

![tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate](https://img.chemicalbook.com/CAS/GIF/896464-16-7.gif)

![tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate hydrochloride](https://img.chemicalbook.com//CAS2/GIF/1023301-84-9.gif)
![tert-Butyl1,7-diazaspiro[4.4]nonane-7-carboxylate](https://img.chemicalbook.com/CAS/GIF/646055-63-2.gif)


