PRODUCT Properties
| Melting point: | 196-198 °C(lit.) |
| Boiling point: | 331.89°C (rough estimate) |
| Density | 1.1985 (rough estimate) |
| refractive index | 78 ° (C=5, 1mol/L HCl) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | almost transparency in 1mol/L HCl |
| pka | 9.96±0.15(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| optical activity | [α]20/D +76°, c = 4.2 in 1 M HCl |
| BRN | 2808635 |
| Major Application | peptide synthesis |
| InChI | 1S/C9H13N3O2/c10-8(9(14)12-11)5-6-1-3-7(13)4-2-6/h1-4,8,13H,5,10-11H2,(H,12,14)/t8-/m0/s1 |
| InChIKey | MWIXENPCUPDSOS-QMMMGPOBSA-N |
| SMILES | NNC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| CAS DataBase Reference | 7662-51-3(CAS DataBase Reference) |
| EPA Substance Registry System | L-Tyrosine, hydrazide (7662-51-3) |
Description and Uses
Excellent reagent for the resolution of amino acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |





