PRODUCT Properties
| Melting point: | 272-273 °C (decomp) |
| Boiling point: | 358.94°C (rough estimate) |
| Density | 1.313 |
| refractive index | 1.6660 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.26±0.10(Predicted) |
| form | solid |
| InChI | 1S/C12H14N2O2/c1-7-2-3-11-9(4-7)8(6-14-11)5-10(13)12(15)16/h2-4,6,10,14H,5,13H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | HUNCSWANZMJLPM-JTQLQIEISA-N |
| SMILES | [N+H3][C@@H](Cc1c2c([nH]c1)ccc(c2)C)C(=O)[O-] |
Description and Uses
5-Methyl-L-tryptophan is a versatile compound th at finds application in biochemical and metabolomics research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
