BD1179732
4-Chloro-6-fluoroquinoline , 97% , 391-77-5
CAS NO.:391-77-5
Empirical Formula: C9H5ClFN
Molecular Weight: 181.59
MDL number: MFCD00278783
EINECS: 672-838-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB83.20 | In Stock |
|
| 10g | RMB146.40 | In Stock |
|
| 25g | RMB350.40 | In Stock |
|
| 100g | RMB1332.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75.0 to 79.0 °C |
| Boiling point: | 259.9±20.0 °C(Predicted) |
| Density | 1.366±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 2.90±0.16(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C9H5ClFN/c10-8-3-4-12-9-2-1-6(11)5-7(8)9/h1-5H |
| InChIKey | CKTQPWIDUQGUGG-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(F)=CC=2)C(Cl)=CC=1 |
| CAS DataBase Reference | 391-77-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-41-37/38 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






