BD1180232
2-Bromo-5-(trifluoromethyl)benzoic acid , 97% , 1483-56-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB35.20 | In Stock |
|
| 5g | RMB87.20 | In Stock |
|
| 10g | RMB168.00 | In Stock |
|
| 25g | RMB401.60 | In Stock |
|
| 100g | RMB1559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-117℃ |
| Boiling point: | 301.0±42.0 °C(Predicted) |
| Density | 1.773 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.42±0.10(Predicted) |
| form | Solid |
| Appearance | White to off-white Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H4BrF3O2/c9-6-2-1-4(8(10,11)12)3-5(6)7(13)14/h1-3H,(H,13,14) |
| InChIKey | REBQGRPKXYIJDC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C(F)(F)F)=CC=C1Br |
| CAS DataBase Reference | 1483-56-3 |
Description and Uses
2-Bromo-5-(trifluoromethyl)benzoic acid is used as an organic synthesis reagent or pharmaceutical intermediate compound.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
