A1394312
2-Bromo-5-(trifluoromethyl)benzaldehyde , 98% , 102684-91-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB144.00 | In Stock |
|
| 25g | RMB608.80 | In Stock |
|
| 100g | RMB2073.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 239.1±35.0 °C(Predicted) |
| Density | 1.677±0.06 g/cm3(Predicted) |
| refractive index | 1.511 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C8H4BrF3O/c9-7-2-1-6(8(10,11)12)3-5(7)4-13/h1-4H |
| InChIKey | CSOBJYGHQOLWOD-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(C(F)(F)F)=CC=C1Br |
| CAS DataBase Reference | 102684-91-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2913000090 |
