BD1185732
2-Bromo-1-(4-(trifluoromethoxy)phenyl)ethanone , 97% , 103962-10-3
Synonym(s):
4-(Trifluoromethoxy)phenacyl bromide
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB44.80 | In Stock |
|
| 5g | RMB156.80 | In Stock |
|
| 10g | RMB290.40 | In Stock |
|
| 25g | RMB605.60 | In Stock |
|
| 100g | RMB1499.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55 °C |
| Boiling point: | 266.0±35.0 °C(Predicted) |
| Density | 1.621±0.06 g/cm3(Predicted) |
| Flash point: | 110 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | Pale yellow |
| InChI | 1S/C9H6BrF3O2/c10-5-8(14)6-1-3-7(4-2-6)15-9(11,12)13/h1-4H,5H2 |
| InChIKey | AOAGGWLQIILIIV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1ccc(cc1)C(=O)CBr |
| CAS DataBase Reference | 103962-10-3(CAS DataBase Reference) |
Description and Uses
2-Bromo-1-[4-(trifluoromethoxy)phenyl]ethan-1-one is an intermediate used to prepare aminothiazoles as therapeutic leads for prion diseases. It is also used in the synthesis of pyrrolidino-tetrahydroisoquinolines as potent dual H3 antagonist and serotonin transporter inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38-36 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | CORROSIVE |
| HS Code | 2914500090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





