PRODUCT Properties
| Melting point: | 140-145 °C(lit.) |
| Boiling point: | 403.46°C (rough estimate) |
| Density | 1.3933 (rough estimate) |
| refractive index | 1.6360 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| InChI | 1S/C12H8N2O5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H |
| InChIKey | MWAGUKZCDDRDCS-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Oc2ccc(cc2)[N+]([O-])=O)cc1 |
| CAS DataBase Reference | 101-63-3(CAS DataBase Reference) |
| EPA Substance Registry System | Bis(4-nitrophenyl) ether (101-63-3) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | KN3450000 |
| TSCA | TSCA listed |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mmo-sat 50 mg/plate CRNGDP 6,1811,85 |
