BD1271932
4-Isopropyl-1-methyl-2-nitrobenzene , 97% , 943-15-7
CAS NO.：943-15-7
Empirical Formula: C10H13NO2
Molecular Weight: 179.22
MDL number: MFCD00007176
EINECS: 213-397-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB62.40 | In Stock |
|
| 5g | RMB196.80 | In Stock |
|
| 10g | RMB344.80 | In Stock |
|
| 25g | RMB660.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 1°C (estimate) |
| Boiling point: | 134 °C / 15mmHg |
| Density | 1.07 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C10H13NO2/c1-7(2)9-5-4-8(3)10(6-9)11(12)13/h4-7H,1-3H3 |
| InChIKey | DRKFWQDBPGTSOO-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C)c(c1)[N+]([O-])=O |
| EPA Substance Registry System | Benzene, 1-methyl-4-(1-methylethyl)-2-nitro- (943-15-7) |
Description and Uses
2-Nitro-p-cymene was used in the synthesis of 5 -isopropyl-8-methylquinoline. It was used as mediator solvent in perchlorate ion-selective electrode with poly(vinyl chloride) matrix membrane on conductive silver-epoxy composite.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P337+P313-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 36/37/39-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2904200090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
