PRODUCT Properties
| Melting point: | 102-104 °C (lit.) |
| Boiling point: | 275.0±9.0 °C(Predicted) |
| Density | 1.141±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| Appearance | Off-white to light yellow Solid |
| Water Solubility | Sparingly Soluble in water (0.070 g/L) (25°C). |
| BRN | 1864209 |
| InChI | 1S/C9H9NO2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2-7H,1H3/b7-6+ |
| InChIKey | JSPNBERPFLONRX-VOTSOKGWSA-N |
| SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1ccc(C)cc1 |
| CAS DataBase Reference | 5153-68-4(CAS DataBase Reference) |
Description and Uses
trans-4-Methyl-β-nitrostyrene may be used as a reagent in the synthesis of N-benzylpyrrolomorphinans. It is also used as an organic intermediate for pharmaceutical.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
