BD1278532
2-(4-Nitrophenyl)propanoic acid , 95% , 19910-33-9
CAS NO.:19910-33-9
Empirical Formula: C9H9NO4
Molecular Weight: 195.17
MDL number: MFCD00012106
EINECS: 243-423-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB27.20 | In Stock |
|
| 1g | RMB59.20 | In Stock |
|
| 5g | RMB268.00 | In Stock |
|
| 25g | RMB1224.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-89 °C(lit.) |
| Boiling point: | 361.9±25.0 °C(Predicted) |
| Density | 1.337±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethanol |
| form | Solid |
| pka | 3.91±0.10(Predicted) |
| color | Light Orange |
| InChI | InChI=1S/C9H9NO4/c1-6(9(11)12)7-2-4-8(5-3-7)10(13)14/h2-6H,1H3,(H,11,12) |
| InChIKey | RBSRRICSXWXMRC-UHFFFAOYSA-N |
| SMILES | C(C)(C(=O)O)C1=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 19910-33-9(CAS DataBase Reference) |
Description and Uses
2-(4-Nitrophenyl)propionic acid is a reagent used in the preparation of α-Methylated analogs of triiodothyroalkanoic acids which have interactions with hepatic thyroid receptors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






