BD1318132
3-Hydroxy-2-methylquinoline-4-carboxylic acid , 98% , 117-57-7
CAS NO.:117-57-7
Empirical Formula: C11H9NO3
Molecular Weight: 203.19
MDL number: MFCD00044850
EINECS: 204-198-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.80 | In Stock |
|
| 10g | RMB34.40 | In Stock |
|
| 25g | RMB72.80 | In Stock |
|
| 100g | RMB252.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 235 °C (dec.) (lit.) |
| Boiling point: | 341.49°C (rough estimate) |
| Density | 1.2621 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.4950 (estimate) |
| Flash point: | 252 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 0.04 g/L (20°C) |
| pka | 0.74±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| Water Solubility | 0.04 g/L (20 ºC) |
| InChI | InChI=1S/C11H9NO3/c1-6-10(13)9(11(14)15)7-4-2-3-5-8(7)12-6/h2-5,13H,1H3,(H,14,15) |
| InChIKey | RVGATDHHYVSTQG-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C(O)=O)=C(O)C=1C |
| LogP | 2.9 |
| CAS DataBase Reference | 117-57-7(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Quinolinecarboxylic acid, 3-hydroxy-2-methyl- (117-57-7) |
Description and Uses
3-Hydroxy-2-methyl-4-quinolinecarboxylic acid may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39-36/37/39-22 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




