BD1322132
3,3-Difluoroazetidine hydrochloride , 97% , 288315-03-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB62.40 | In Stock |
|
| 5g | RMB231.20 | In Stock |
|
| 10g | RMB440.00 | In Stock |
|
| 25g | RMB1042.40 | In Stock |
|
| 100g | RMB3550.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-143 °C |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Solid |
| color | Off-White to Light Yellow |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C3H5F2N.ClH/c4-3(5)1-6-2-3;/h6H,1-2H2;1H |
| InChIKey | CDBAEFXTCRKJPZ-UHFFFAOYSA-N |
| SMILES | FC1(CNC1)F.Cl |
| CAS DataBase Reference | 288315-03-7(CAS DataBase Reference) |
Description and Uses
3,3-Difluoroazetidine Hydrochloride is used in preparation of Dihydropyrimidine compounds as antiviral agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





