BD1342932
Tricin , 95% , 520-32-1
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB463.20 | In Stock |
|
| 50mg | RMB656.80 | In Stock |
|
| 100mg | RMB932.00 | In Stock |
|
| 250mg | RMB1490.40 | In Stock |
|
| 1g | RMB3874.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 289~291℃ |
| Boiling point: | 598.5±50.0 °C(Predicted) |
| Density | 1.483±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Dichloromethane (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 6.48±0.40(Predicted) |
| color | Yellow to Dark Yellow |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN PROTECTING SKIN CONDITIONING |
| InChI | InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)17(14)21)12-7-11(20)16-10(19)5-9(18)6-13(16)24-12/h3-7,18-19,21H,1-2H3 |
| InChIKey | HRGUSFBJBOKSML-UHFFFAOYSA-N |
| SMILES | C1(C2=CC(OC)=C(O)C(OC)=C2)OC2=CC(O)=CC(O)=C2C(=O)C=1 |
Description and Uses
Tricin is a type of flavanoid studied for its immunomodulatory effects.
Safety
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |





