BD1343032
5-Chloro-1,3,3-trimethyl-2-methyleneindoline , 95% , 6872-17-9
CAS NO.：6872-17-9
Empirical Formula: C12H14ClN
Molecular Weight: 207.7
MDL number: MFCD00005814
EINECS: 229-972-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB75.20 | In Stock |
|
| 5g | RMB155.20 | In Stock |
|
| 10g | RMB259.20 | In Stock |
|
| 25g | RMB419.20 | In Stock |
|
| 100g | RMB1672.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 139 °C / 11mmHg |
| Density | 1.083 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| pka | 1.12±0.40(Predicted) |
| Specific Gravity | 1.083 |
| color | Orange to Brown to Dark purple |
| InChI | 1S/C12H14ClN/c1-8-12(2,3)10-7-9(13)5-6-11(10)14(8)4/h5-7H,1H2,2-4H3 |
| InChIKey | VDMXGJJMPKAYQP-UHFFFAOYSA-N |
| SMILES | CN1C(=C)C(C)(C)c2cc(Cl)ccc12 |
| CAS DataBase Reference | 6872-17-9(CAS DataBase Reference) |
Description and Uses
5-Chloro-2-methylene-1,3,3-trimethylindoline was used in the synthesis of 5′,6-dichloro-1′,3′,3′-trimethyl-spiro-[2H-1-benzopyran-2,2′-indoline].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
