BD1363132
3-Amino-5-bromobenzoic acid , 97% , 42237-85-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5g | RMB84.00 | In Stock |
|
| 10g | RMB156.80 | In Stock |
|
| 25g | RMB375.20 | In Stock |
|
| 100g | RMB1425.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-221 °C |
| Boiling point: | 398.3±32.0 °C(Predicted) |
| Density | 1.793 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 3.97±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6BrNO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,9H2,(H,10,11) |
| InChIKey | RQSXRGSPGHZKFT-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC(N)=C1 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2922498590 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






