BD1403848
2-(Hydroxymethyl)anthracene-9,10-dione , 98+% , 17241-59-7
Synonym(s):
2-Hydroxymethyl-9,10-anthracenedione
CAS NO.:17241-59-7
Empirical Formula: C15H10O3
Molecular Weight: 238.24
MDL number: MFCD00001236
EINECS: 241-274-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1433.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-197 °C(lit.) |
| Boiling point: | 340.83°C (rough estimate) |
| Density | 1.2068 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | chloroform/methanol: soluble2%, clear to slightly hazy, colorless to yellow |
| pka | 14.05±0.10(Predicted) |
| form | Solid |
| color | light yellow |
| BRN | 2120452 |
| InChI | 1S/C15H10O3/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17/h1-7,16H,8H2 |
| InChIKey | JYKHAJGLEVKEAA-UHFFFAOYSA-N |
| SMILES | OCc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
| LogP | 2.200 (est) |
| CAS DataBase Reference | 17241-59-7(CAS DataBase Reference) |
Description and Uses
2-(Hydroxymethyl)anthraquinone (a photoremovable protecting group) was used to chemically cage (Z)-11-hexadecen-1-ol (sex pheromone of Chilo infuscatellus snellen).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | CB7600000 |
| F | 8 |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |





