BD1431232
Oxetane-3-carboxylic acid , 95% , 114012-41-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB226.40 | In Stock |
|
| 250mg | RMB335.20 | In Stock |
|
| 1g | RMB959.20 | In Stock |
|
| 5g | RMB3391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 244℃ |
| Density | 1.374 |
| refractive index | 1.492 |
| Flash point: | 115°(239°F) |
| storage temp. | -20°C |
| pka | 3.88±0.20(Predicted) |
| form | liquid |
| Appearance | white to yellow oil or semi-solid |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C4H6O3/c5-4(6)3-1-7-2-3/h3H,1-2H2,(H,5,6) |
| InChIKey | UWOTZNQZPLAURK-UHFFFAOYSA-N |
| SMILES | O1CC(C(O)=O)C1 |
| CAS DataBase Reference | 114012-41-8 |
Description and Uses
Oxetane-3-carboxylic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |








