BD1431532
                    tert-Butyl 3-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate , 97% , 954236-44-3
| Pack Size | Price | Stock | Quantity | 
| 100mg | RMB134.40 | In Stock |  | 
| 250mg | RMB193.60 | In Stock |  | 
| 1g | RMB576.00 | In Stock |  | 
| 5g | RMB2195.20 | In Stock |  | 
| 10g | RMB3951.20 | In Stock |  | 
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 65-66 °C(Solv: hexane (110-54-3)) | 
| Boiling point: | 375.5±42.0 °C(Predicted) | 
| Density | 1.16 | 
| storage temp. | 2-8°C | 
| pka | -0.85±0.20(Predicted) | 
| Appearance | Off-white to light yellow Solid | 
| InChI | InChI=1S/C13H21NO4/c1-12(2,3)18-11(16)14-6-4-13(5-7-14)8-10(15)9-17-13/h4-9H2,1-3H3 | 
| InChIKey | XDSCHYPLQWGQRC-UHFFFAOYSA-N | 
| SMILES | O1C2(CCN(C(OC(C)(C)C)=O)CC2)CC(=O)C1 | 
Description and Uses
tert-Butyl 3-Oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate is used as a reactant in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 | 
| Signal word | Warning | 
| Hazard statements | H302-H335-H315-H319 | 
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P | 

![tert-Butyl 3-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate](https://img.chemicalbook.com/CAS/GIF/954236-44-3.gif)

![1-Oxa-8-azaspiro[4.5]decane](https://img.chemicalbook.com/CAS/GIF/176-92-1.gif)
![1-Oxa-8-azaspiro[4.5]decan-3-one hydrochloride](https://img.chemicalbook.com/CAS/GIF/133382-42-0.gif)