BD1431548
2-Amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoicacid , 97% , 16063-80-2
Synonym(s):
2-Amino-4,4,4-trifluoro-3-(trifluoromethyl)butyric acid;4,4,4,5,5,5-Hexafluoro-DL -valine
CAS NO.:16063-80-2
Empirical Formula: C5H5F6NO2
Molecular Weight: 225.09
MDL number: MFCD00014349
EINECS: 240-207-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2409.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204°C (dec.) |
| Boiling point: | 165.9±40.0 °C(Predicted) |
| Density | 1.575±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 1.53±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2416649 |
| Major Application | peptide synthesis |
| InChI | 1S/C5H5F6NO2/c6-4(7,8)2(5(9,10)11)1(12)3(13)14/h1-2H,12H2,(H,13,14) |
| InChIKey | KRNSHCKTGFAMPQ-UHFFFAOYSA-N |
| SMILES | NC(C(C(F)(F)F)C(F)(F)F)C(O)=O |
| CAS DataBase Reference | 16063-80-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |




