BD1432532
1-tert-Butyl 4-ethyl 3-oxopiperidine-1,4-dicarboxylate , 97% , 71233-25-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB80.80 | In Stock |
|
| 10g | RMB152.80 | In Stock |
|
| 25g | RMB312.00 | In Stock |
|
| 100g | RMB1228.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 364.6±42.0 °C(Predicted) |
| Density | 1.152±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 11.17±0.20(Predicted) |
| form | Liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C13H21NO5/c1-5-18-11(16)9-6-7-14(8-10(9)15)12(17)19-13(2,3)4/h9H,5-8H2,1-4H3 |
| InChIKey | WCTXJAXKORIYNA-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(C(OCC)=O)C(=O)C1 |
Description and Uses
1-tert-Butyl 4-Ethyl 3-Oxopiperidine-1,4-dicarboxylate is a reactant used in the synthesis of heteroaryl N-sulfonamides which demonstrate cell-death.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2933399990 |
