BD1438748
7-Bromo-9H-fluoren-2-amine , 90% , 6638-60-4
CAS NO.：6638-60-4
Empirical Formula: C13H10BrN
Molecular Weight: 260.13
MDL number: MFCD00001127
EINECS: 625-606-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB110.40 | In Stock |
|
| 1g | RMB308.00 | In Stock |
|
| 5g | RMB1076.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-149 °C (lit.) |
| Boiling point: | 431.9±38.0 °C(Predicted) |
| Density | 1.559±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| pka | 3.90±0.20(Predicted) |
| form | powder |
| Appearance | Off-white to light yellow Solid |
| Water Solubility | Sparingly soluble in water. (0.724 mg/L) |
| InChI | InChI=1S/C13H10BrN/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5,15H2 |
| InChIKey | RJWYTISHBMNMOZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(Br)=C2)C2=C1C=C(N)C=C2 |
| CAS DataBase Reference | 6638-60-4(CAS DataBase Reference) |
Description and Uses
It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | LL5150050 |
