BD1442332
4-(2-Bromoethyl)-2-oxoindole , 97% , 120427-96-5
CAS NO.:120427-96-5
Empirical Formula: C10H10BrNO
Molecular Weight: 240.1
MDL number:
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 25g | RMB4081.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155°C |
| Boiling point: | 373.8±42.0 °C(Predicted) |
| Density | 1.528 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.05±0.20(Predicted) |
| color | Yellow to Dark Yellow |
| InChI | InChI=1S/C10H10BrNO/c11-5-4-7-2-1-3-9-8(7)6-10(13)12-9/h1-3H,4-6H2,(H,12,13) |
| InChIKey | KJFSOQQZVCONSQ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(CCBr)=CC=C2)CC1=O |
Description and Uses
4-(2-BroMoethyl)-1,3-dihydro-2H-indolin-2-one can be used as a useful synthetic intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |





