BD1451632
tert-Butyl 4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperazine-1-carboxylate , 95% , 470478-90-1
CAS NO.:470478-90-1
Empirical Formula: C21H33BN2O4
Molecular Weight: 388.31
MDL number: MFCD06411544
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB92.80 | In Stock |
|
| 5g | RMB380.00 | In Stock |
|
| 10g | RMB632.00 | In Stock |
|
| 25g | RMB1216.00 | In Stock |
|
| 100g | RMB4792.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157 °C |
| Boiling point: | 501.7±45.0 °C(Predicted) |
| Density | 1.11 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 3.06±0.10(Predicted) |
| color | Off-white to light yellow |
| InChI | 1S/C21H33BN2O4/c1-19(2,3)26-18(25)24-14-12-23(13-15-24)17-10-8-16(9-11-17)22-27-20(4,5)21(6,7)28-22/h8-11H,12-15H2,1-7H3 |
| InChIKey | ZMAVVXGWEHZLDW-UHFFFAOYSA-N |
| SMILES | O=C(N1CCN(C2=CC=C(B3OC(C)(C)C(C)(C)O3)C=C2)CC1)OC(C)(C)C |
Description and Uses
tert-Butyl 4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperazine-1-carboxylate (cas# 470478-90-1) is a useful reactant for the preparation of 211At- and 125I-radiolabeled compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| Hazard Note | Harmful |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |







![(4-[4-(tert-Butoxycarbonyl)piperazin-1-yl]phenyl)boronicacid](https://img.chemicalbook.com/CAS/GIF/457613-78-4.gif)