T8698930
N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline , >98.0%(GC) , 920304-57-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB792.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 377.0±25.0 °C(Predicted) |
| Density | 0.99±0.1 g/cm3(Predicted) |
| refractive index | 1.504 |
| Flash point: | 181.82ºC |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Methanol |
| pka | 6.23±0.44(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C16H26BNO2/c1-7-18(8-2)14-11-9-13(10-12-14)17-19-15(3,4)16(5,6)20-17/h9-12H,7-8H2,1-6H3 |
| InChIKey | WVPMYKCIKQQJIV-UHFFFAOYSA-N |
| SMILES | C1(N(CC)CC)=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1 |
Description and Uses
N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is an organoborane compound used as an intermediate in the manufacture of battery or probe materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2931900090 |





