BD1455432
4-(Chlorodifluoromethoxy)aniline , 97% , 39065-95-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB48.00 | In Stock |
|
| 1g | RMB146.40 | In Stock |
|
| 5g | RMB700.80 | In Stock |
|
| 10g | RMB1270.40 | In Stock |
|
| 25g | RMB3025.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 231.9±40.0 °C(Predicted) |
| Density | 1.402±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Chloroform (Slightly), DMSO (Sparingly) |
| pka | 4.04±0.10(Predicted) |
| form | liquid |
| color | Pale yellow |
| InChI | InChI=1S/C7H6ClF2NO/c8-7(9,10)12-6-3-1-5(11)2-4-6/h1-4H,11H2 |
| InChIKey | QDTUQGSYECRXDO-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(OC(Cl)(F)F)C=C1 |
Description and Uses
4-Chlorodifluoromethoxyaniline has been used as a reactant for the preparation of arylphthalazines as a potent and orally bioavailable inhibitor of VEGFR-2.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-43-22 |
| Safety Statements | 26-36/37/39-36/37 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 2921420090 |
| Storage Class | 11 - Combustible Solids |




