BD1476932
1,10-Phenanthroline-4,7-diol , 97% , 3922-40-5
Synonym(s):
1,10-Phenanthroline-4,7-diol
CAS NO.:3922-40-5
Empirical Formula: C12H8N2O2
Molecular Weight: 212.2
MDL number: MFCD00004975
EINECS: 223-493-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB29.60 | In Stock |
|
| 250mg | RMB46.40 | In Stock |
|
| 1g | RMB136.00 | In Stock |
|
| 5g | RMB653.60 | In Stock |
|
| 10g | RMB1260.80 | In Stock |
|
| 25g | RMB2722.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (dec.)(lit.) |
| Boiling point: | 515.8±45.0 °C(Predicted) |
| Density | 1.505±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 3.81±0.30(Predicted) |
| form | Powder |
| color | Yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Hygroscopic |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C12H8N2O2/c15-9-3-5-13-11-7(9)1-2-8-10(16)4-6-14-12(8)11/h1-6H,(H,13,15)(H,14,16) |
| InChIKey | SLIBCJURSADKPV-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C3C=2N=CC=C3O)C(O)=CC=1 |
| EPA Substance Registry System | 1,10-Phenanthroline-4,7-diol (3922-40-5) |
Description and Uses
4,7-Dihydroxy-1,10-phenanthroline is used as a phenanthroline stain. Its iron(II) complex reacts rapidly with dissolved oxygen in aqueous solution, thereby it is utilized for the spectrophotometric determination of dissolved oxygen up to 20 ppm.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







